C26H25N3O3 — CID 18230254
2-[4-(4-cyanophenyl)phenoxy]-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide (PubChem CID 18230254) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)phenoxy]-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide.
| Compound Name | 2-[4-(4-cyanophenyl)phenoxy]-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18230254 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-[4-(4-cyanophenyl)phenoxy]-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide |
| SMILES | N#Cc1ccc(-c2ccc(OCC(=O)Nc3ccc(CN4CCOCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O3/c27-17-20-1-5-22(6-2-20)23-7-11-25(12-8-23)32-19-26(30)28-24-9-3-21(4-10-24)18-29-13-15-31-16-14-29/h1-12H,13-16,18-19H2,(H,28,30) |
| InChIKey | YZGSFKXKARSFBH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |