C30H29N3O4 — CID 24518314
[2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate (PubChem CID 24518314) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate.
| Compound Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 24518314 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | [2-[4-(morpholin-4-ylmethyl)anilino]-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)OCC(=O)Nc1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C30H29N3O4/c1-21-28(25-9-5-6-10-26(25)32-29(21)23-7-3-2-4-8-23)30(35)37-20-27(34)31-24-13-11-22(12-14-24)19-33-15-17-36-18-16-33/h2-14H,15-20H2,1H3,(H,31,34) |
| InChIKey | IYOPXLKTCKLLDA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |