C17H15FN2O6 — CID 8607719
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-ethoxybenzoate (PubChem CID 8607719) has the molecular formula C17H15FN2O6 and a molecular weight of 362.31 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-ethoxybenzoate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 8607719 |
| Molecular Formula | C17H15FN2O6 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCC(=O)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C17H15FN2O6/c1-2-25-15-6-4-3-5-12(15)17(22)26-10-16(21)19-14-9-11(20(23)24)7-8-13(14)18/h3-9H,2,10H2,1H3,(H,19,21) |
| InChIKey | WLQDDGBSGLHEMP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|