About [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate (PubChem CID 2505089) has the molecular formula C15H9ClFN3O7
and a molecular weight of 397.70 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate.
Molecular Properties
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate |
| PubChem CID | 2505089 |
| Molecular Formula | C15H9ClFN3O7 |
| Molecular Weight | 397.70 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)cc1[N+](=O)[O-])Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C15H9ClFN3O7/c16-8-1-3-10(13(5-8)20(25)26)15(22)27-7-14(21)18-12-6-9(19(23)24)2-4-11(12)17/h1-6H,7H2,(H,18,21) |
| InChIKey | NWLSXYOPKSIHKM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate?
The IUPAC name of [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate (CID 2505089) is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate.
What is the SMILES notation for [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate?
The canonical SMILES for [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate is O=C(COC(=O)c1ccc(Cl)cc1[N+](=O)[O-])Nc1cc([N+](=O)[O-])ccc1F.
What is the InChIKey of [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate?
The InChIKey is NWLSXYOPKSIHKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClFN3O7/c16-8-1-3-10(13(5-8)20(25)26)15(22)27-7-14(21)18-12-6-9(19(23)24)2-4-11(12)17/h1-6H,7H2,(H,18,21).
What are the key properties of [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate?
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate has a molecular weight of 397.70 g/mol, XLogP of 3.09, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 4-chloro-2-nitrobenzoate is sourced from PubChem (CID 2505089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).