C15H9ClF2N2O5 — CID 7763878
[2-(5-chloro-2-nitroanilino)-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 7763878) has the molecular formula C15H9ClF2N2O5 and a molecular weight of 370.70 g/mol. Its IUPAC name is [2-(5-chloro-2-nitroanilino)-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 7763878 |
| Molecular Formula | C15H9ClF2N2O5 |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1F)Nc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H9ClF2N2O5/c16-8-1-4-13(20(23)24)12(5-8)19-14(21)7-25-15(22)10-3-2-9(17)6-11(10)18/h1-6H,7H2,(H,19,21) |
| InChIKey | WERCLVOJYBAWRG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|