C20H19N3O5 — CID 4884982
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(benzylamino)-3-nitrobenzoate (PubChem CID 4884982) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(benzylamino)-3-nitrobenzoate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(benzylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 4884982 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(benzylamino)-3-nitrobenzoate |
| SMILES | Cc1noc(C)c1COC(=O)c1ccc(NCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N3O5/c1-13-17(14(2)28-22-13)12-27-20(24)16-8-9-18(19(10-16)23(25)26)21-11-15-6-4-3-5-7-15/h3-10,21H,11-12H2,1-2H3 |
| InChIKey | GXROZWYSHKUWRA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|