C23H27N3O5 — CID 7405781
[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-(benzylamino)-3-nitrobenzoate (PubChem CID 7405781) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-(benzylamino)-3-nitrobenzoate.
| Compound Name | [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-(benzylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7405781 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 4-(benzylamino)-3-nitrobenzoate |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)COC(=O)c2ccc(NCc3ccccc3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C23H27N3O5/c1-16-10-17(2)14-25(13-16)22(27)15-31-23(28)19-8-9-20(21(11-19)26(29)30)24-12-18-6-4-3-5-7-18/h3-9,11,16-17,24H,10,12-15H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | SIUMVXPSQNQHLG-IAGOWNOFSA-N |
| XLogP | 3.87 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|