C20H23N3O4 — CID 34281724
[4-(benzylamino)-3-nitrophenyl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 34281724) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is [4-(benzylamino)-3-nitrophenyl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [4-(benzylamino)-3-nitrophenyl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 34281724 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [4-(benzylamino)-3-nitrophenyl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(NCc3ccccc3)c([N+](=O)[O-])c2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H23N3O4/c1-14-12-22(13-15(2)27-14)20(24)17-8-9-18(19(10-17)23(25)26)21-11-16-6-4-3-5-7-16/h3-10,14-15,21H,11-13H2,1-2H3/t14-,15+ |
| InChIKey | POFKGISBOSSUME-GASCZTMLSA-N |
| XLogP | 3.46 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|