C23H20N4O4 — CID 16960740
(8-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-(benzylamino)-3-nitrobenzoate (PubChem CID 16960740) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-(benzylamino)-3-nitrobenzoate.
| Compound Name | (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-(benzylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 16960740 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (8-methylimidazo[1,2-a]pyridin-2-yl)methyl 4-(benzylamino)-3-nitrobenzoate |
| SMILES | Cc1cccn2cc(COC(=O)c3ccc(NCc4ccccc4)c([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C23H20N4O4/c1-16-6-5-11-26-14-19(25-22(16)26)15-31-23(28)18-9-10-20(21(12-18)27(29)30)24-13-17-7-3-2-4-8-17/h2-12,14,24H,13,15H2,1H3 |
| InChIKey | NIRMIUMUPABVOM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|