C16H13F3N4O4S — CID 133423043
N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline (PubChem CID 133423043) has the molecular formula C16H13F3N4O4S and a molecular weight of 414.37 g/mol. Its IUPAC name is N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133423043 |
| Molecular Formula | C16H13F3N4O4S |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline |
| SMILES | Cc1cccn2cc(CNc3ccc(S(=O)(=O)C(F)(F)F)cc3[N+](=O)[O-])nc12 |
| InChI | InChI=1S/C16H13F3N4O4S/c1-10-3-2-6-22-9-11(21-15(10)22)8-20-13-5-4-12(7-14(13)23(24)25)28(26,27)16(17,18)19/h2-7,9,20H,8H2,1H3 |
| InChIKey | COEIWXFFIVVWBC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|