C13H13F3N4O5S — CID 133355632
N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline (PubChem CID 133355632) has the molecular formula C13H13F3N4O5S and a molecular weight of 394.33 g/mol. Its IUPAC name is N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133355632 |
| Molecular Formula | C13H13F3N4O5S |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]-2-nitro-4-(trifluoromethylsulfonyl)aniline |
| SMILES | CCC(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-])c1noc(C)n1 |
| InChI | InChI=1S/C13H13F3N4O5S/c1-3-9(12-17-7(2)25-19-12)18-10-5-4-8(6-11(10)20(21)22)26(23,24)13(14,15)16/h4-6,9,18H,3H2,1-2H3 |
| InChIKey | KCZASUQOUHVWPU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|