C15H14F3N3O5S — CID 99794891
(2S)-2-[2-nitro-4-(trifluoromethylsulfonyl)anilino]-3-pyridin-2-ylpropan-1-ol (PubChem CID 99794891) has the molecular formula C15H14F3N3O5S and a molecular weight of 405.35 g/mol. Its IUPAC name is (2S)-2-[2-nitro-4-(trifluoromethylsulfonyl)anilino]-3-pyridin-2-ylpropan-1-ol.
| Compound Name | (2S)-2-[2-nitro-4-(trifluoromethylsulfonyl)anilino]-3-pyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 99794891 |
| Molecular Formula | C15H14F3N3O5S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (2S)-2-[2-nitro-4-(trifluoromethylsulfonyl)anilino]-3-pyridin-2-ylpropan-1-ol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)(F)F)ccc1N[C@H](CO)Cc1ccccn1 |
| InChI | InChI=1S/C15H14F3N3O5S/c16-15(17,18)27(25,26)12-4-5-13(14(8-12)21(23)24)20-11(9-22)7-10-3-1-2-6-19-10/h1-6,8,11,20,22H,7,9H2/t11-/m0/s1 |
| InChIKey | JTNVESZHZUGNBA-NSHDSACASA-N |
| XLogP | 2.30 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|