C16H14F3N3O4S — CID 55393742
N-cyclopropyl-2-nitro-N-(pyridin-2-ylmethyl)-4-(trifluoromethylsulfonyl)aniline (PubChem CID 55393742) has the molecular formula C16H14F3N3O4S and a molecular weight of 401.37 g/mol. Its IUPAC name is N-cyclopropyl-2-nitro-N-(pyridin-2-ylmethyl)-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-cyclopropyl-2-nitro-N-(pyridin-2-ylmethyl)-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 55393742 |
| Molecular Formula | C16H14F3N3O4S |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-cyclopropyl-2-nitro-N-(pyridin-2-ylmethyl)-4-(trifluoromethylsulfonyl)aniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)C(F)(F)F)ccc1N(Cc1ccccn1)C1CC1 |
| InChI | InChI=1S/C16H14F3N3O4S/c17-16(18,19)27(25,26)13-6-7-14(15(9-13)22(23)24)21(12-4-5-12)10-11-3-1-2-8-20-11/h1-3,6-9,12H,4-5,10H2 |
| InChIKey | OVCUWVYFUPJXRF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|