C9H10F3N3O4 — CID 106749403
2-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propane-1,3-diol (PubChem CID 106749403) has the molecular formula C9H10F3N3O4 and a molecular weight of 281.19 g/mol. Its IUPAC name is 2-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propane-1,3-diol.
| Compound Name | 2-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 106749403 |
| Molecular Formula | C9H10F3N3O4 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propane-1,3-diol |
| SMILES | O=[N+]([O-])c1cnc(C(F)(F)F)cc1NC(CO)CO |
| InChI | InChI=1S/C9H10F3N3O4/c10-9(11,12)8-1-6(14-5(3-16)4-17)7(2-13-8)15(18)19/h1-2,5,16-17H,3-4H2,(H,13,14) |
| InChIKey | HCVLGXGHFWAXNL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|