C9H8F5N3O3 — CID 106832583
1,1-difluoro-3-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propan-2-ol (PubChem CID 106832583) has the molecular formula C9H8F5N3O3 and a molecular weight of 301.17 g/mol. Its IUPAC name is 1,1-difluoro-3-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propan-2-ol.
| Compound Name | 1,1-difluoro-3-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 106832583 |
| Molecular Formula | C9H8F5N3O3 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1,1-difluoro-3-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propan-2-ol |
| SMILES | O=[N+]([O-])c1cnc(C(F)(F)F)cc1NCC(O)C(F)F |
| InChI | InChI=1S/C9H8F5N3O3/c10-8(11)6(18)3-15-4-1-7(9(12,13)14)16-2-5(4)17(19)20/h1-2,6,8,18H,3H2,(H,15,16) |
| InChIKey | SRYVPRXEXOBWLU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|