C8H9F2N3O3 — CID 103731329
1,1-difluoro-3-[(3-nitro-4-pyridinyl)amino]propan-2-ol (PubChem CID 103731329) has the molecular formula C8H9F2N3O3 and a molecular weight of 233.17 g/mol. Its IUPAC name is 1,1-difluoro-3-[(3-nitro-4-pyridinyl)amino]propan-2-ol.
| Compound Name | 1,1-difluoro-3-[(3-nitro-4-pyridinyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 103731329 |
| Molecular Formula | C8H9F2N3O3 |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1,1-difluoro-3-[(3-nitro-4-pyridinyl)amino]propan-2-ol |
| SMILES | O=[N+]([O-])c1cnccc1NCC(O)C(F)F |
| InChI | InChI=1S/C8H9F2N3O3/c9-8(10)7(14)4-12-5-1-2-11-3-6(5)13(15)16/h1-3,7-8,14H,4H2,(H,11,12) |
| InChIKey | DJVKTRRSLVHLGD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|