C11H14F3N3O4 — CID 106832593
1-methoxy-4-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]butan-2-ol (PubChem CID 106832593) has the molecular formula C11H14F3N3O4 and a molecular weight of 309.24 g/mol. Its IUPAC name is 1-methoxy-4-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]butan-2-ol.
| Compound Name | 1-methoxy-4-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 106832593 |
| Molecular Formula | C11H14F3N3O4 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-methoxy-4-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]butan-2-ol |
| SMILES | COCC(O)CCNc1cc(C(F)(F)F)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14F3N3O4/c1-21-6-7(18)2-3-15-8-4-10(11(12,13)14)16-5-9(8)17(19)20/h4-5,7,18H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | AFIWCRVNOOVDGN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|