C12H16F3N3O3 — CID 106832565
N-(5-methoxypentyl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine (PubChem CID 106832565) has the molecular formula C12H16F3N3O3 and a molecular weight of 307.27 g/mol. Its IUPAC name is N-(5-methoxypentyl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine.
| Compound Name | N-(5-methoxypentyl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 106832565 |
| Molecular Formula | C12H16F3N3O3 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(5-methoxypentyl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
| SMILES | COCCCCCNc1cc(C(F)(F)F)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16F3N3O3/c1-21-6-4-2-3-5-16-9-7-11(12(13,14)15)17-8-10(9)18(19)20/h7-8H,2-6H2,1H3,(H,16,17) |
| InChIKey | LTQGHAACSBWTJG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|