C8H12N4O3 — CID 130469784
4-N-(2-methoxyethyl)-5-nitropyridine-2,4-diamine (PubChem CID 130469784) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 4-N-(2-methoxyethyl)-5-nitropyridine-2,4-diamine.
| Compound Name | 4-N-(2-methoxyethyl)-5-nitropyridine-2,4-diamine |
|---|---|
| PubChem CID | 130469784 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 4-N-(2-methoxyethyl)-5-nitropyridine-2,4-diamine |
| SMILES | COCCNc1cc(N)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N4O3/c1-15-3-2-10-6-4-8(9)11-5-7(6)12(13)14/h4-5H,2-3H2,1H3,(H3,9,10,11) |
| InChIKey | NCLZAJCNPYYRCM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|