C11H16N2O5 — CID 83008459
4,5-dimethoxy-N-(2-methoxyethyl)-2-nitroaniline (PubChem CID 83008459) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4,5-dimethoxy-N-(2-methoxyethyl)-2-nitroaniline.
| Compound Name | 4,5-dimethoxy-N-(2-methoxyethyl)-2-nitroaniline |
|---|---|
| PubChem CID | 83008459 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4,5-dimethoxy-N-(2-methoxyethyl)-2-nitroaniline |
| SMILES | COCCNc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O5/c1-16-5-4-12-8-6-10(17-2)11(18-3)7-9(8)13(14)15/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | IZJAFPRPMMIELS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|