C11H16N4O5 — CID 83113274
2-(4,5-dimethoxy-2-nitroanilino)ethylurea (PubChem CID 83113274) has the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitroanilino)ethylurea.
| Compound Name | 2-(4,5-dimethoxy-2-nitroanilino)ethylurea |
|---|---|
| PubChem CID | 83113274 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitroanilino)ethylurea |
| SMILES | COc1cc(NCCNC(N)=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C11H16N4O5/c1-19-9-5-7(13-3-4-14-11(12)16)8(15(17)18)6-10(9)20-2/h5-6,13H,3-4H2,1-2H3,(H3,12,14,16) |
| InChIKey | NSUIVLOPTPSIGR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|