C13H21N3O5 — CID 104594213
1-[2-(4,5-dimethoxy-2-nitroanilino)ethylamino]propan-2-ol (PubChem CID 104594213) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-[2-(4,5-dimethoxy-2-nitroanilino)ethylamino]propan-2-ol.
| Compound Name | 1-[2-(4,5-dimethoxy-2-nitroanilino)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 104594213 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-[2-(4,5-dimethoxy-2-nitroanilino)ethylamino]propan-2-ol |
| SMILES | COc1cc(NCCNCC(C)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H21N3O5/c1-9(17)8-14-4-5-15-10-6-12(20-2)13(21-3)7-11(10)16(18)19/h6-7,9,14-15,17H,4-5,8H2,1-3H3 |
| InChIKey | AZHRSEPIGHMTSX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|