C11H14F3N3O3S — CID 106749635
N-(3-methylsulfinylbutyl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine (PubChem CID 106749635) has the molecular formula C11H14F3N3O3S and a molecular weight of 325.31 g/mol. Its IUPAC name is N-(3-methylsulfinylbutyl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine.
| Compound Name | N-(3-methylsulfinylbutyl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 106749635 |
| Molecular Formula | C11H14F3N3O3S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-(3-methylsulfinylbutyl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
| SMILES | CC(CCNc1cc(C(F)(F)F)ncc1[N+](=O)[O-])S(C)=O |
| InChI | InChI=1S/C11H14F3N3O3S/c1-7(21(2)20)3-4-15-8-5-10(11(12,13)14)16-6-9(8)17(18)19/h5-7H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | IZFDKJYKYVPCFT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|