C9H9F3N4O3 — CID 106748995
2-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propanamide (PubChem CID 106748995) has the molecular formula C9H9F3N4O3 and a molecular weight of 278.19 g/mol. Its IUPAC name is 2-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propanamide.
| Compound Name | 2-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 106748995 |
| Molecular Formula | C9H9F3N4O3 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-[[5-nitro-2-(trifluoromethyl)-4-pyridinyl]amino]propanamide |
| SMILES | CC(Nc1cc(C(F)(F)F)ncc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C9H9F3N4O3/c1-4(8(13)17)15-5-2-7(9(10,11)12)14-3-6(5)16(18)19/h2-4H,1H3,(H2,13,17)(H,14,15) |
| InChIKey | WNQIANGWHZVUES-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|