C12H12F3N3O2 — CID 106231519
N-hex-1-yn-3-yl-5-nitro-2-(trifluoromethyl)pyridin-4-amine (PubChem CID 106231519) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-5-nitro-2-(trifluoromethyl)pyridin-4-amine.
| Compound Name | N-hex-1-yn-3-yl-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 106231519 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-hex-1-yn-3-yl-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
| SMILES | C#CC(CCC)Nc1cc(C(F)(F)F)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12F3N3O2/c1-3-5-8(4-2)17-9-6-11(12(13,14)15)16-7-10(9)18(19)20/h2,6-8H,3,5H2,1H3,(H,16,17) |
| InChIKey | WNBAYTSWOGIKDE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|