C13H21N3O5S — CID 42909678
4-(1-hydroxybutan-2-ylamino)-3-nitro-N-propan-2-ylbenzenesulfonamide (PubChem CID 42909678) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is 4-(1-hydroxybutan-2-ylamino)-3-nitro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-(1-hydroxybutan-2-ylamino)-3-nitro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 42909678 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 4-(1-hydroxybutan-2-ylamino)-3-nitro-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCC(CO)Nc1ccc(S(=O)(=O)NC(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N3O5S/c1-4-10(8-17)14-12-6-5-11(7-13(12)16(18)19)22(20,21)15-9(2)3/h5-7,9-10,14-15,17H,4,8H2,1-3H3 |
| InChIKey | UFIXRJDFWLJOQN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|