C19H23F2N3O5S — CID 95781832
4-[[(1S,2R)-1-(2,6-difluorophenyl)-1-hydroxybutan-2-yl]amino]-3-nitro-N-propan-2-ylbenzenesulfonamide (PubChem CID 95781832) has the molecular formula C19H23F2N3O5S and a molecular weight of 443.47 g/mol. Its IUPAC name is 4-[[(1S,2R)-1-(2,6-difluorophenyl)-1-hydroxybutan-2-yl]amino]-3-nitro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[[(1S,2R)-1-(2,6-difluorophenyl)-1-hydroxybutan-2-yl]amino]-3-nitro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 95781832 |
| Molecular Formula | C19H23F2N3O5S |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-[[(1S,2R)-1-(2,6-difluorophenyl)-1-hydroxybutan-2-yl]amino]-3-nitro-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC[C@@H](Nc1ccc(S(=O)(=O)NC(C)C)cc1[N+](=O)[O-])[C@@H](O)c1c(F)cccc1F |
| InChI | InChI=1S/C19H23F2N3O5S/c1-4-15(19(25)18-13(20)6-5-7-14(18)21)22-16-9-8-12(10-17(16)24(26)27)30(28,29)23-11(2)3/h5-11,15,19,22-23,25H,4H2,1-3H3/t15-,19-/m1/s1 |
| InChIKey | XVTJPESLWJXOKV-DNVCBOLYSA-N |
| XLogP | 3.48 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|