C12H13N3O4 — CID 65314483
2-[(5-nitroquinolin-8-yl)amino]propane-1,3-diol (PubChem CID 65314483) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-[(5-nitroquinolin-8-yl)amino]propane-1,3-diol.
| Compound Name | 2-[(5-nitroquinolin-8-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 65314483 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-[(5-nitroquinolin-8-yl)amino]propane-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(NC(CO)CO)c2ncccc12 |
| InChI | InChI=1S/C12H13N3O4/c16-6-8(7-17)14-10-3-4-11(15(18)19)9-2-1-5-13-12(9)10/h1-5,8,14,16-17H,6-7H2 |
| InChIKey | LMZUGZRGYGDLKV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|