C22H20N6O4 — CID 3119298
N,N'-bis(5-nitroquinolin-8-yl)butane-1,4-diamine (PubChem CID 3119298) has the molecular formula C22H20N6O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is N,N'-bis(5-nitroquinolin-8-yl)butane-1,4-diamine.
| Compound Name | N,N'-bis(5-nitroquinolin-8-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 3119298 |
| Molecular Formula | C22H20N6O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N,N'-bis(5-nitroquinolin-8-yl)butane-1,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCCCNc2ccc([N+](=O)[O-])c3cccnc23)c2ncccc12 |
| InChI | InChI=1S/C22H20N6O4/c29-27(30)19-9-7-17(21-15(19)5-3-13-25-21)23-11-1-2-12-24-18-8-10-20(28(31)32)16-6-4-14-26-22(16)18/h3-10,13-14,23-24H,1-2,11-12H2 |
| InChIKey | FLKRMVNEPHRNFJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|