C13H12N6O2 — CID 64529666
5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinolin-8-amine (PubChem CID 64529666) has the molecular formula C13H12N6O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is 5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinolin-8-amine.
| Compound Name | 5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinolin-8-amine |
|---|---|
| PubChem CID | 64529666 |
| Molecular Formula | C13H12N6O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 5-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinolin-8-amine |
| SMILES | O=[N+]([O-])c1ccc(NCCc2ncn[nH]2)c2ncccc12 |
| InChI | InChI=1S/C13H12N6O2/c20-19(21)11-4-3-10(13-9(11)2-1-6-15-13)14-7-5-12-16-8-17-18-12/h1-4,6,8,14H,5,7H2,(H,16,17,18) |
| InChIKey | YUXMGICJLNOHCS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|