C13H12N6O3 — CID 86804798
5-[2-[(5-nitroquinolin-8-yl)amino]ethyl]-1,3,4-oxadiazol-2-amine (PubChem CID 86804798) has the molecular formula C13H12N6O3 and a molecular weight of 300.28 g/mol. Its IUPAC name is 5-[2-[(5-nitroquinolin-8-yl)amino]ethyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[2-[(5-nitroquinolin-8-yl)amino]ethyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 86804798 |
| Molecular Formula | C13H12N6O3 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-[2-[(5-nitroquinolin-8-yl)amino]ethyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(CCNc2ccc([N+](=O)[O-])c3cccnc23)o1 |
| InChI | InChI=1S/C13H12N6O3/c14-13-18-17-11(22-13)5-7-15-9-3-4-10(19(20)21)8-2-1-6-16-12(8)9/h1-4,6,15H,5,7H2,(H2,14,18) |
| InChIKey | OYCUYOQJJSRIPN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|