C13H16N4O2 — CID 60895239
N'-(8-nitroquinolin-5-yl)butane-1,4-diamine (PubChem CID 60895239) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N'-(8-nitroquinolin-5-yl)butane-1,4-diamine.
| Compound Name | N'-(8-nitroquinolin-5-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 60895239 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N'-(8-nitroquinolin-5-yl)butane-1,4-diamine |
| SMILES | NCCCCNc1ccc([N+](=O)[O-])c2ncccc12 |
| InChI | InChI=1S/C13H16N4O2/c14-7-1-2-8-15-11-5-6-12(17(18)19)13-10(11)4-3-9-16-13/h3-6,9,15H,1-2,7-8,14H2 |
| InChIKey | OBFNBOBWJJDPEP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|