C15H18N4O2 — CID 115308115
2-cyclopropyl-2-N-(8-nitroquinolin-5-yl)propane-1,2-diamine (PubChem CID 115308115) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-cyclopropyl-2-N-(8-nitroquinolin-5-yl)propane-1,2-diamine.
| Compound Name | 2-cyclopropyl-2-N-(8-nitroquinolin-5-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 115308115 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-cyclopropyl-2-N-(8-nitroquinolin-5-yl)propane-1,2-diamine |
| SMILES | CC(CN)(Nc1ccc([N+](=O)[O-])c2ncccc12)C1CC1 |
| InChI | InChI=1S/C15H18N4O2/c1-15(9-16,10-4-5-10)18-12-6-7-13(19(20)21)14-11(12)3-2-8-17-14/h2-3,6-8,10,18H,4-5,9,16H2,1H3 |
| InChIKey | MZMBMRSWCGPVDA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|