C15H20N4O2 — CID 115306174
2-ethyl-1-N-(8-nitroquinolin-5-yl)butane-1,2-diamine (PubChem CID 115306174) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-ethyl-1-N-(8-nitroquinolin-5-yl)butane-1,2-diamine.
| Compound Name | 2-ethyl-1-N-(8-nitroquinolin-5-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 115306174 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-ethyl-1-N-(8-nitroquinolin-5-yl)butane-1,2-diamine |
| SMILES | CCC(N)(CC)CNc1ccc([N+](=O)[O-])c2ncccc12 |
| InChI | InChI=1S/C15H20N4O2/c1-3-15(16,4-2)10-18-12-7-8-13(19(20)21)14-11(12)6-5-9-17-14/h5-9,18H,3-4,10,16H2,1-2H3 |
| InChIKey | VOOMOWHHTLZMPF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|