C13H15N3O4 — CID 107390120
N-(2,2-dimethoxyethyl)-8-nitroquinolin-5-amine (PubChem CID 107390120) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-8-nitroquinolin-5-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-8-nitroquinolin-5-amine |
|---|---|
| PubChem CID | 107390120 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-8-nitroquinolin-5-amine |
| SMILES | COC(CNc1ccc([N+](=O)[O-])c2ncccc12)OC |
| InChI | InChI=1S/C13H15N3O4/c1-19-12(20-2)8-15-10-5-6-11(16(17)18)13-9(10)4-3-7-14-13/h3-7,12,15H,8H2,1-2H3 |
| InChIKey | PCHHSSVRMWBBNX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|