C12H13FN4O2 — CID 83164489
N'-(7-fluoro-5-nitroquinolin-8-yl)propane-1,3-diamine (PubChem CID 83164489) has the molecular formula C12H13FN4O2 and a molecular weight of 264.26 g/mol. Its IUPAC name is N'-(7-fluoro-5-nitroquinolin-8-yl)propane-1,3-diamine.
| Compound Name | N'-(7-fluoro-5-nitroquinolin-8-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 83164489 |
| Molecular Formula | C12H13FN4O2 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N'-(7-fluoro-5-nitroquinolin-8-yl)propane-1,3-diamine |
| SMILES | NCCCNc1c(F)cc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C12H13FN4O2/c13-9-7-10(17(18)19)8-3-1-5-15-11(8)12(9)16-6-2-4-14/h1,3,5,7,16H,2,4,6,14H2 |
| InChIKey | GNOVZWJYBGFNDA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|