C12H14N4O4S — CID 120706703
N-(3-aminopropyl)-5-nitroquinoline-8-sulfonamide (PubChem CID 120706703) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-nitroquinoline-8-sulfonamide.
| Compound Name | N-(3-aminopropyl)-5-nitroquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 120706703 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-(3-aminopropyl)-5-nitroquinoline-8-sulfonamide |
| SMILES | NCCCNS(=O)(=O)c1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C12H14N4O4S/c13-6-2-8-15-21(19,20)11-5-4-10(16(17)18)9-3-1-7-14-12(9)11/h1,3-5,7,15H,2,6,8,13H2 |
| InChIKey | KMURVXBVDNXCSI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|