C14H18N4O4S — CID 120715909
5-nitro-N-[2-(propylamino)ethyl]quinoline-8-sulfonamide (PubChem CID 120715909) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is 5-nitro-N-[2-(propylamino)ethyl]quinoline-8-sulfonamide.
| Compound Name | 5-nitro-N-[2-(propylamino)ethyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 120715909 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 5-nitro-N-[2-(propylamino)ethyl]quinoline-8-sulfonamide |
| SMILES | CCCNCCNS(=O)(=O)c1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C14H18N4O4S/c1-2-7-15-9-10-17-23(21,22)13-6-5-12(18(19)20)11-4-3-8-16-14(11)13/h3-6,8,15,17H,2,7,9-10H2,1H3 |
| InChIKey | ZYEHIFKZEQHILC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|