C17H23ClN4O4S — CID 120711965
N-[[1-(5-nitroquinolin-8-yl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride (PubChem CID 120711965) has the molecular formula C17H23ClN4O4S and a molecular weight of 414.92 g/mol. Its IUPAC name is N-[[1-(5-nitroquinolin-8-yl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride.
| Compound Name | N-[[1-(5-nitroquinolin-8-yl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120711965 |
| Molecular Formula | C17H23ClN4O4S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[[1-(5-nitroquinolin-8-yl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride |
| SMILES | CCNCC1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])c3cccnc23)CC1.Cl |
| InChI | InChI=1S/C17H22N4O4S.ClH/c1-2-18-12-13-7-10-20(11-8-13)26(24,25)16-6-5-15(21(22)23)14-4-3-9-19-17(14)16;/h3-6,9,13,18H,2,7-8,10-12H2,1H3;1H |
| InChIKey | PZTVXAJSPBPHLO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|