C15H16N4O3 — CID 133441769
N-(cyclopropylmethyl)-2-[(5-nitroquinolin-8-yl)amino]acetamide (PubChem CID 133441769) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[(5-nitroquinolin-8-yl)amino]acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-[(5-nitroquinolin-8-yl)amino]acetamide |
|---|---|
| PubChem CID | 133441769 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[(5-nitroquinolin-8-yl)amino]acetamide |
| SMILES | O=C(CNc1ccc([N+](=O)[O-])c2cccnc12)NCC1CC1 |
| InChI | InChI=1S/C15H16N4O3/c20-14(18-8-10-3-4-10)9-17-12-5-6-13(19(21)22)11-2-1-7-16-15(11)12/h1-2,5-7,10,17H,3-4,8-9H2,(H,18,20) |
| InChIKey | CGPYMSSXNGSOPY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|