C12H14IN3O3 — CID 133441931
N-(cyclopropylmethyl)-2-(4-iodo-2-nitroanilino)acetamide (PubChem CID 133441931) has the molecular formula C12H14IN3O3 and a molecular weight of 375.17 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(4-iodo-2-nitroanilino)acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-(4-iodo-2-nitroanilino)acetamide |
|---|---|
| PubChem CID | 133441931 |
| Molecular Formula | C12H14IN3O3 |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(4-iodo-2-nitroanilino)acetamide |
| SMILES | O=C(CNc1ccc(I)cc1[N+](=O)[O-])NCC1CC1 |
| InChI | InChI=1S/C12H14IN3O3/c13-9-3-4-10(11(5-9)16(18)19)14-7-12(17)15-6-8-1-2-8/h3-5,8,14H,1-2,6-7H2,(H,15,17) |
| InChIKey | PJGCFPFOVUFSFL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|