C15H19ClN4O4S — CID 120712067
N-methyl-1-[1-(5-nitroquinolin-8-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 120712067) has the molecular formula C15H19ClN4O4S and a molecular weight of 386.86 g/mol. Its IUPAC name is N-methyl-1-[1-(5-nitroquinolin-8-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | N-methyl-1-[1-(5-nitroquinolin-8-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120712067 |
| Molecular Formula | C15H19ClN4O4S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-methyl-1-[1-(5-nitroquinolin-8-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | CNCC1CCCN1S(=O)(=O)c1ccc([N+](=O)[O-])c2cccnc12.Cl |
| InChI | InChI=1S/C15H18N4O4S.ClH/c1-16-10-11-4-3-9-18(11)24(22,23)14-7-6-13(19(20)21)12-5-2-8-17-15(12)14;/h2,5-8,11,16H,3-4,9-10H2,1H3;1H |
| InChIKey | OIFKYRZDJWGIAM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|