C15H18N4O2 — CID 83067222
N-methyl-1-[1-(8-nitroquinolin-4-yl)pyrrolidin-2-yl]methanamine (PubChem CID 83067222) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-methyl-1-[1-(8-nitroquinolin-4-yl)pyrrolidin-2-yl]methanamine.
| Compound Name | N-methyl-1-[1-(8-nitroquinolin-4-yl)pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 83067222 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-methyl-1-[1-(8-nitroquinolin-4-yl)pyrrolidin-2-yl]methanamine |
| SMILES | CNCC1CCCN1c1ccnc2c([N+](=O)[O-])cccc12 |
| InChI | InChI=1S/C15H18N4O2/c1-16-10-11-4-3-9-18(11)13-7-8-17-15-12(13)5-2-6-14(15)19(20)21/h2,5-8,11,16H,3-4,9-10H2,1H3 |
| InChIKey | GUAXQIBWZJBWMX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|