C13H16N4O3S — CID 104850380
4-[(5-aminoquinolin-8-yl)sulfonylamino]butanamide (PubChem CID 104850380) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-[(5-aminoquinolin-8-yl)sulfonylamino]butanamide.
| Compound Name | 4-[(5-aminoquinolin-8-yl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 104850380 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-[(5-aminoquinolin-8-yl)sulfonylamino]butanamide |
| SMILES | NC(=O)CCCNS(=O)(=O)c1ccc(N)c2cccnc12 |
| InChI | InChI=1S/C13H16N4O3S/c14-10-5-6-11(13-9(10)3-1-7-16-13)21(19,20)17-8-2-4-12(15)18/h1,3,5-7,17H,2,4,8,14H2,(H2,15,18) |
| InChIKey | MHHRAFOTMXISGU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|