C13H12N4O3S — CID 106413888
5-amino-N-(1,2-oxazol-5-ylmethyl)quinoline-8-sulfonamide (PubChem CID 106413888) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 5-amino-N-(1,2-oxazol-5-ylmethyl)quinoline-8-sulfonamide.
| Compound Name | 5-amino-N-(1,2-oxazol-5-ylmethyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 106413888 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 5-amino-N-(1,2-oxazol-5-ylmethyl)quinoline-8-sulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCc2ccno2)c2ncccc12 |
| InChI | InChI=1S/C13H12N4O3S/c14-11-3-4-12(13-10(11)2-1-6-15-13)21(18,19)17-8-9-5-7-16-20-9/h1-7,17H,8,14H2 |
| InChIKey | DJNIURANXGKXKG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|