C13H16N4O3S — CID 104850364
N-[2-[(5-aminoquinolin-8-yl)sulfonylamino]ethyl]acetamide (PubChem CID 104850364) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[2-[(5-aminoquinolin-8-yl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(5-aminoquinolin-8-yl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 104850364 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-[2-[(5-aminoquinolin-8-yl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1ccc(N)c2cccnc12 |
| InChI | InChI=1S/C13H16N4O3S/c1-9(18)15-7-8-17-21(19,20)12-5-4-11(14)10-3-2-6-16-13(10)12/h2-6,17H,7-8,14H2,1H3,(H,15,18) |
| InChIKey | XNXXFMRKSPTCEX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|