C23H24N4O4S2 — CID 55559982
8-methyl-N-[3-[(8-methylquinolin-5-yl)sulfonylamino]propyl]quinoline-5-sulfonamide (PubChem CID 55559982) has the molecular formula C23H24N4O4S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 8-methyl-N-[3-[(8-methylquinolin-5-yl)sulfonylamino]propyl]quinoline-5-sulfonamide.
| Compound Name | 8-methyl-N-[3-[(8-methylquinolin-5-yl)sulfonylamino]propyl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 55559982 |
| Molecular Formula | C23H24N4O4S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 8-methyl-N-[3-[(8-methylquinolin-5-yl)sulfonylamino]propyl]quinoline-5-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNS(=O)(=O)c2ccc(C)c3ncccc23)c2cccnc12 |
| InChI | InChI=1S/C23H24N4O4S2/c1-16-8-10-20(18-6-3-12-24-22(16)18)32(28,29)26-14-5-15-27-33(30,31)21-11-9-17(2)23-19(21)7-4-13-25-23/h3-4,6-13,26-27H,5,14-15H2,1-2H3 |
| InChIKey | BSJJISNWBSIZLJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|