C18H21N3O2S2 — CID 134002347
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-8-methylquinoline-5-sulfonamide (PubChem CID 134002347) has the molecular formula C18H21N3O2S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-8-methylquinoline-5-sulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-8-methylquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 134002347 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-8-methylquinoline-5-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(c2cccs2)N(C)C)c2cccnc12 |
| InChI | InChI=1S/C18H21N3O2S2/c1-13-8-9-17(14-6-4-10-19-18(13)14)25(22,23)20-12-15(21(2)3)16-7-5-11-24-16/h4-11,15,20H,12H2,1-3H3 |
| InChIKey | JNZULNKVAQNNFQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |