C15H22ClN3O2S — CID 84591254
N-(2-amino-3-methylbutyl)-8-methylquinoline-5-sulfonamide;hydrochloride (PubChem CID 84591254) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is N-(2-amino-3-methylbutyl)-8-methylquinoline-5-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-3-methylbutyl)-8-methylquinoline-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 84591254 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-(2-amino-3-methylbutyl)-8-methylquinoline-5-sulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NCC(N)C(C)C)c2cccnc12.Cl |
| InChI | InChI=1S/C15H21N3O2S.ClH/c1-10(2)13(16)9-18-21(19,20)14-7-6-11(3)15-12(14)5-4-8-17-15;/h4-8,10,13,18H,9,16H2,1-3H3;1H |
| InChIKey | PAKJQSRWHNPIQQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |