C13H16N4O2S — CID 104774314
3-[(8-methylquinolin-5-yl)sulfonylamino]propanimidamide (PubChem CID 104774314) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-[(8-methylquinolin-5-yl)sulfonylamino]propanimidamide.
| Compound Name | 3-[(8-methylquinolin-5-yl)sulfonylamino]propanimidamide |
|---|---|
| PubChem CID | 104774314 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-[(8-methylquinolin-5-yl)sulfonylamino]propanimidamide |
| SMILES | [H]/N=C(\N)CCNS(=O)(=O)c1ccc(C)c2ncccc12 |
| InChI | InChI=1S/C13H16N4O2S/c1-9-4-5-11(10-3-2-7-16-13(9)10)20(18,19)17-8-6-12(14)15/h2-5,7,17H,6,8H2,1H3,(H3,14,15) |
| InChIKey | NJFWHLVLLURJPN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|